C21H43IN4OS — CID 111716285
2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine;hydroiodide (PubChem CID 111716285) has the molecular formula C21H43IN4OS and a molecular weight of 526.57 g/mol. Its IUPAC name is 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111716285 |
| Molecular Formula | C21H43IN4OS |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)NCC1(N2CCSCC2)CCCC1.I |
| InChI | InChI=1S/C21H42N4OS.HI/c1-4-20(5-2,11-14-26)17-23-19(22-6-3)24-18-21(9-7-8-10-21)25-12-15-27-16-13-25;/h26H,4-18H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | FPPOOOJJAHWSQX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|