C18H30N4S2 — CID 111939351
1-ethyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-2-(thiophen-3-ylmethyl)guanidine (PubChem CID 111939351) has the molecular formula C18H30N4S2 and a molecular weight of 366.60 g/mol. Its IUPAC name is 1-ethyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-2-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-2-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111939351 |
| Molecular Formula | C18H30N4S2 |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-ethyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-2-(thiophen-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccsc1)NCC1(N2CCSCC2)CCCC1 |
| InChI | InChI=1S/C18H30N4S2/c1-2-19-17(20-13-16-5-10-24-14-16)21-15-18(6-3-4-7-18)22-8-11-23-12-9-22/h5,10,14H,2-4,6-9,11-13,15H2,1H3,(H2,19,20,21) |
| InChIKey | FAJQQPPQJLYTBD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|