C19H23NO3S — CID 111719972
N-(2-hydroxy-2-thiophen-2-ylpropyl)-4-(2-methoxyphenyl)-3-methylbut-2-enamide (PubChem CID 111719972) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-ylpropyl)-4-(2-methoxyphenyl)-3-methylbut-2-enamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)-4-(2-methoxyphenyl)-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 111719972 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)-4-(2-methoxyphenyl)-3-methylbut-2-enamide |
| SMILES | COc1ccccc1CC(C)=CC(=O)NCC(C)(O)c1cccs1 |
| InChI | InChI=1S/C19H23NO3S/c1-14(11-15-7-4-5-8-16(15)23-3)12-18(21)20-13-19(2,22)17-9-6-10-24-17/h4-10,12,22H,11,13H2,1-3H3,(H,20,21) |
| InChIKey | AWGJUWPBXYPFBT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|