C17H26N4O2 — CID 111722528
1-cyclopropyl-1-(4-hydroxybutyl)-3-(2-pyrrolidin-1-yl-3-pyridinyl)urea (PubChem CID 111722528) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-cyclopropyl-1-(4-hydroxybutyl)-3-(2-pyrrolidin-1-yl-3-pyridinyl)urea.
| Compound Name | 1-cyclopropyl-1-(4-hydroxybutyl)-3-(2-pyrrolidin-1-yl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 111722528 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-cyclopropyl-1-(4-hydroxybutyl)-3-(2-pyrrolidin-1-yl-3-pyridinyl)urea |
| SMILES | O=C(Nc1cccnc1N1CCCC1)N(CCCCO)C1CC1 |
| InChI | InChI=1S/C17H26N4O2/c22-13-4-3-12-21(14-7-8-14)17(23)19-15-6-5-9-18-16(15)20-10-1-2-11-20/h5-6,9,14,22H,1-4,7-8,10-13H2,(H,19,23) |
| InChIKey | VVJULYLYIJRVSF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|