C22H34IN5 — CID 111723312
N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethyl-3-phenylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111723312) has the molecular formula C22H34IN5 and a molecular weight of 495.45 g/mol. Its IUPAC name is N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethyl-3-phenylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethyl-3-phenylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111723312 |
| Molecular Formula | C22H34IN5 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethyl-3-phenylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)Cn1nc(C)cc1C)N1CCC(c2ccccc2)C1.I |
| InChI | InChI=1S/C22H33N5.HI/c1-5-23-22(24-14-17(2)15-27-19(4)13-18(3)25-27)26-12-11-21(16-26)20-9-7-6-8-10-20;/h6-10,13,17,21H,5,11-12,14-16H2,1-4H3,(H,23,24);1H |
| InChIKey | VZSZWYZZCPISPP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|