C17H16N2 — CID 11172700
9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indole (PubChem CID 11172700) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indole.
| Compound Name | 9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indole |
|---|---|
| PubChem CID | 11172700 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indole |
| SMILES | c1ccc(-n2c3c(c4cccnc42)CCCC3)cc1 |
| InChI | InChI=1S/C17H16N2/c1-2-7-13(8-3-1)19-16-11-5-4-9-14(16)15-10-6-12-18-17(15)19/h1-3,6-8,10,12H,4-5,9,11H2 |
| InChIKey | ZAJNXZPRFLKDOX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |