C53H40N2 — CID 58663528
9-[3,5-bis(3,5-diphenylphenyl)phenyl]-5,6,7,8-tetrahydropyrido[2,3-b]indole (PubChem CID 58663528) has the molecular formula C53H40N2 and a molecular weight of 704.92 g/mol. Its IUPAC name is 9-[3,5-bis(3,5-diphenylphenyl)phenyl]-5,6,7,8-tetrahydropyrido[2,3-b]indole.
| Compound Name | 9-[3,5-bis(3,5-diphenylphenyl)phenyl]-5,6,7,8-tetrahydropyrido[2,3-b]indole |
|---|---|
| PubChem CID | 58663528 |
| Molecular Formula | C53H40N2 |
| Molecular Weight | 704.92 g/mol |
| Exact Mass | 704.32 |
| IUPAC Name | 9-[3,5-bis(3,5-diphenylphenyl)phenyl]-5,6,7,8-tetrahydropyrido[2,3-b]indole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)cc(-n4c5c(c6cccnc64)CCCC5)c3)c2)cc1 |
| InChI | InChI=1S/C53H40N2/c1-5-16-37(17-6-1)41-28-42(38-18-7-2-8-19-38)31-45(30-41)47-34-48(36-49(35-47)55-52-26-14-13-24-50(52)51-25-15-27-54-53(51)55)46-32-43(39-20-9-3-10-21-39)29-44(33-46)40-22-11-4-12-23-40/h1-12,15-23,25,27-36H,13-14,24,26H2 |
| InChIKey | IUBNAXXNYFFFTI-UHFFFAOYSA-N |
| XLogP | 13.91 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.92 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |