C25H41IN4O3 — CID 111732706
N'-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N-ethyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide (PubChem CID 111732706) has the molecular formula C25H41IN4O3 and a molecular weight of 572.53 g/mol. Its IUPAC name is N'-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N-ethyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N-ethyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111732706 |
| Molecular Formula | C25H41IN4O3 |
| Molecular Weight | 572.53 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | N'-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-N-ethyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(OC)c(OC)c1)N1CCOCC1)N1CCC2(CCCC2)C1.I |
| InChI | InChI=1S/C25H40N4O3.HI/c1-4-26-24(29-12-11-25(19-29)9-5-6-10-25)27-18-21(28-13-15-32-16-14-28)20-7-8-22(30-2)23(17-20)31-3;/h7-8,17,21H,4-6,9-16,18-19H2,1-3H3,(H,26,27);1H |
| InChIKey | NXNFGPDGOCJXLK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|