C16H30N6 — CID 111734931
N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(2-methylpropyl)pyrrolidine-1-carboximidamide (PubChem CID 111734931) has the molecular formula C16H30N6 and a molecular weight of 306.46 g/mol. Its IUPAC name is N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(2-methylpropyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(2-methylpropyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111734931 |
| Molecular Formula | C16H30N6 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.25 |
| IUPAC Name | N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(2-methylpropyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1nncn1CC)N1CCC(CC(C)C)C1 |
| InChI | InChI=1S/C16H30N6/c1-5-17-16(18-10-15-20-19-12-21(15)6-2)22-8-7-14(11-22)9-13(3)4/h12-14H,5-11H2,1-4H3,(H,17,18) |
| InChIKey | WYISWBMAHBVSRG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|