C21H35IN6O2 — CID 111735206
1-[3-[[[ethylamino-[3-(methoxymethyl)pyrrolidin-1-yl]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111735206) has the molecular formula C21H35IN6O2 and a molecular weight of 530.46 g/mol. Its IUPAC name is 1-[3-[[[ethylamino-[3-(methoxymethyl)pyrrolidin-1-yl]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[[ethylamino-[3-(methoxymethyl)pyrrolidin-1-yl]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111735206 |
| Molecular Formula | C21H35IN6O2 |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 1-[3-[[[ethylamino-[3-(methoxymethyl)pyrrolidin-1-yl]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCCC(C(N)=O)C1)N1CCC(COC)C1.I |
| InChI | InChI=1S/C21H34N6O2.HI/c1-3-23-21(27-11-8-16(13-27)15-29-2)25-12-17-6-4-9-24-20(17)26-10-5-7-18(14-26)19(22)28;/h4,6,9,16,18H,3,5,7-8,10-15H2,1-2H3,(H2,22,28)(H,23,25);1H |
| InChIKey | ADECCYHNMFNOIG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|