C16H34N4O — CID 111736523
N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111736523) has the molecular formula C16H34N4O and a molecular weight of 298.47 g/mol. Its IUPAC name is N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111736523 |
| Molecular Formula | C16H34N4O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)(C)CN(C)C)N1CCC(COC)C1 |
| InChI | InChI=1S/C16H34N4O/c1-7-17-15(18-12-16(2,3)13-19(4)5)20-9-8-14(10-20)11-21-6/h14H,7-13H2,1-6H3,(H,17,18) |
| InChIKey | ZLNHATLTKQDYQQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|