C20H30O — CID 11173704
(1R,2S,2'S,4R,5R,7R)-2'-ethenyl-5,8,8-trimethyl-2-prop-2-enylspiro[bicyclo[5.1.0]octane-4,1'-cyclopentane]-3-one (PubChem CID 11173704) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (1R,2S,2'S,4R,5R,7R)-2'-ethenyl-5,8,8-trimethyl-2-prop-2-enylspiro[bicyclo[5.1.0]octane-4,1'-cyclopentane]-3-one.
| Compound Name | (1R,2S,2'S,4R,5R,7R)-2'-ethenyl-5,8,8-trimethyl-2-prop-2-enylspiro[bicyclo[5.1.0]octane-4,1'-cyclopentane]-3-one |
|---|---|
| PubChem CID | 11173704 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (1R,2S,2'S,4R,5R,7R)-2'-ethenyl-5,8,8-trimethyl-2-prop-2-enylspiro[bicyclo[5.1.0]octane-4,1'-cyclopentane]-3-one |
| SMILES | C=CC[C@@H]1C(=O)[C@]2(CCC[C@H]2C=C)[C@H](C)C[C@@H]2[C@H]1C2(C)C |
| InChI | InChI=1S/C20H30O/c1-6-9-15-17-16(19(17,4)5)12-13(3)20(18(15)21)11-8-10-14(20)7-2/h6-7,13-17H,1-2,8-12H2,3-5H3/t13-,14-,15+,16-,17+,20-/m1/s1 |
| InChIKey | ZWXZGEKEBBQPER-DRVJKLOYSA-N |
| XLogP | 5.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|