C19H28O — CID 177458923
(1R,5S,10R,12R,14R)-7,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadec-6-en-15-one (PubChem CID 177458923) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is (1R,5S,10R,12R,14R)-7,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadec-6-en-15-one.
| Compound Name | (1R,5S,10R,12R,14R)-7,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadec-6-en-15-one |
|---|---|
| PubChem CID | 177458923 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (1R,5S,10R,12R,14R)-7,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadec-6-en-15-one |
| SMILES | CC1=C[C@@H]2CCC[C@]23C(=O)C(C1)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C19H28O/c1-11-8-13-6-5-7-19(13)12(2)10-15-16(18(15,3)4)14(9-11)17(19)20/h8,12-16H,5-7,9-10H2,1-4H3/t12-,13+,14?,15-,16+,19-/m1/s1 |
| InChIKey | RHIDOKXJOCVGHM-XOAHRMTBSA-N |
| XLogP | 4.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|