C23H36IN5O2 — CID 111746044
3-(2-methoxyethoxymethyl)-N'-methyl-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111746044) has the molecular formula C23H36IN5O2 and a molecular weight of 541.48 g/mol. Its IUPAC name is 3-(2-methoxyethoxymethyl)-N'-methyl-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111746044 |
| Molecular Formula | C23H36IN5O2 |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCCCc1cn(-c2ccccc2)nc1C)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C23H35N5O2.HI/c1-19-21(17-28(26-19)22-9-5-4-6-10-22)8-7-12-25-23(24-2)27-13-11-20(16-27)18-30-15-14-29-3;/h4-6,9-10,17,20H,7-8,11-16,18H2,1-3H3,(H,24,25);1H |
| InChIKey | IVUJWYOLQLTZNU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|