C22H44N4O3 — CID 111747364
N-ethyl-N'-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111747364) has the molecular formula C22H44N4O3 and a molecular weight of 412.62 g/mol. Its IUPAC name is N-ethyl-N'-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111747364 |
| Molecular Formula | C22H44N4O3 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.34 |
| IUPAC Name | N-ethyl-N'-(3-ethyl-2-morpholin-4-ylpentyl)-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C(CC)CC)N1CCOCC1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C22H44N4O3/c1-5-20(6-2)21(25-10-12-28-13-11-25)16-24-22(23-7-3)26-9-8-19(17-26)18-29-15-14-27-4/h19-21H,5-18H2,1-4H3,(H,23,24) |
| InChIKey | SWYLIAVYJBKUPM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|