C19H27NO2 — CID 111750704
N-[2-(4-tert-butylphenyl)-2-hydroxyethyl]bicyclo[3.1.0]hexane-6-carboxamide (PubChem CID 111750704) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)-2-hydroxyethyl]bicyclo[3.1.0]hexane-6-carboxamide.
| Compound Name | N-[2-(4-tert-butylphenyl)-2-hydroxyethyl]bicyclo[3.1.0]hexane-6-carboxamide |
|---|---|
| PubChem CID | 111750704 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)-2-hydroxyethyl]bicyclo[3.1.0]hexane-6-carboxamide |
| SMILES | CC(C)(C)c1ccc(C(O)CNC(=O)C2C3CCCC32)cc1 |
| InChI | InChI=1S/C19H27NO2/c1-19(2,3)13-9-7-12(8-10-13)16(21)11-20-18(22)17-14-5-4-6-15(14)17/h7-10,14-17,21H,4-6,11H2,1-3H3,(H,20,22) |
| InChIKey | HTJPHTXLGPPWSS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |