C18H26N2O3 — CID 111422615
N-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-6-oxopiperidine-3-carboxamide (PubChem CID 111422615) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | N-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 111422615 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-6-oxopiperidine-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(C(O)CNC(=O)C2CCC(=O)NC2)cc1 |
| InChI | InChI=1S/C18H26N2O3/c1-18(2,3)14-7-4-12(5-8-14)15(21)11-20-17(23)13-6-9-16(22)19-10-13/h4-5,7-8,13,15,21H,6,9-11H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | QRAIQKUKAQLQMA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |