C20H23BrN4O2 — CID 111753957
2-[(4-bromophenyl)methyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine (PubChem CID 111753957) has the molecular formula C20H23BrN4O2 and a molecular weight of 431.33 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine.
| Compound Name | 2-[(4-bromophenyl)methyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111753957 |
| Molecular Formula | C20H23BrN4O2 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine |
| SMILES | Cc1noc(C)c1CN/C(=N/Cc1ccc(Br)cc1)NCCc1ccco1 |
| InChI | InChI=1S/C20H23BrN4O2/c1-14-19(15(2)27-25-14)13-24-20(22-10-9-18-4-3-11-26-18)23-12-16-5-7-17(21)8-6-16/h3-8,11H,9-10,12-13H2,1-2H3,(H2,22,23,24) |
| InChIKey | VRWGPQGQYOLVAX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|