C16H24F3N3O2 — CID 111754586
1-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-[3-(hydroxymethyl)pentan-3-yl]urea (PubChem CID 111754586) has the molecular formula C16H24F3N3O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 1-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-[3-(hydroxymethyl)pentan-3-yl]urea.
| Compound Name | 1-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-[3-(hydroxymethyl)pentan-3-yl]urea |
|---|---|
| PubChem CID | 111754586 |
| Molecular Formula | C16H24F3N3O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 1-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-[3-(hydroxymethyl)pentan-3-yl]urea |
| SMILES | CCC(CC)(CO)NC(=O)Nc1ccc(N(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C16H24F3N3O2/c1-5-15(6-2,10-23)21-14(24)20-13-8-7-11(22(3)4)9-12(13)16(17,18)19/h7-9,23H,5-6,10H2,1-4H3,(H2,20,21,24) |
| InChIKey | DQHHTEADEITKFH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |