C19H32ClN5O — CID 111755235
2-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine (PubChem CID 111755235) has the molecular formula C19H32ClN5O and a molecular weight of 381.95 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine.
| Compound Name | 2-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 111755235 |
| Molecular Formula | C19H32ClN5O |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1ccc(Cl)cc1)N(C)C)NCCN1CCOCC1 |
| InChI | InChI=1S/C19H32ClN5O/c1-4-21-19(22-9-10-25-11-13-26-14-12-25)23-15-18(24(2)3)16-5-7-17(20)8-6-16/h5-8,18H,4,9-15H2,1-3H3,(H2,21,22,23) |
| InChIKey | VSLWRQSCXKXMBK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|