C10H20F2N4O — CID 111757696
2-(2,2-difluoroethyl)-1-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111757696) has the molecular formula C10H20F2N4O and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-1-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-(2,2-difluoroethyl)-1-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111757696 |
| Molecular Formula | C10H20F2N4O |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2-(2,2-difluoroethyl)-1-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | N/C(=N\CC(F)F)NCCCN1CCOCC1 |
| InChI | InChI=1S/C10H20F2N4O/c11-9(12)8-15-10(13)14-2-1-3-16-4-6-17-7-5-16/h9H,1-8H2,(H3,13,14,15) |
| InChIKey | RSCYJFOVVZKFSH-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|