C13H19BrIN3O2S — CID 111759282
1-[2-(4-bromophenyl)sulfonylethyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide (PubChem CID 111759282) has the molecular formula C13H19BrIN3O2S and a molecular weight of 488.19 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)sulfonylethyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-bromophenyl)sulfonylethyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111759282 |
| Molecular Formula | C13H19BrIN3O2S |
| Molecular Weight | 488.19 g/mol |
| Exact Mass | 486.94 |
| IUPAC Name | 1-[2-(4-bromophenyl)sulfonylethyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\C)NCCS(=O)(=O)c1ccc(Br)cc1.I |
| InChI | InChI=1S/C13H18BrN3O2S.HI/c1-3-8-16-13(15-2)17-9-10-20(18,19)12-6-4-11(14)5-7-12;/h3-7H,1,8-10H2,2H3,(H2,15,16,17);1H |
| InChIKey | IQKSDMPNMGSYPB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|