C23H33N5O3 — CID 111762147
2-[[N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 111762147) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is 2-[[N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111762147 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 2-[[N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | COc1ccc(C/N=C(\NCC(=O)N(C)C)NCC(c2ccco2)N2CCCC2)cc1 |
| InChI | InChI=1S/C23H33N5O3/c1-27(2)22(29)17-26-23(24-15-18-8-10-19(30-3)11-9-18)25-16-20(21-7-6-14-31-21)28-12-4-5-13-28/h6-11,14,20H,4-5,12-13,15-17H2,1-3H3,(H2,24,25,26) |
| InChIKey | YEKJVQNOGSNSEU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|