C20H31N3OS — CID 111762955
2-(2-benzylsulfinylethyl)-1-[2-(cyclohexen-1-yl)ethyl]-3-ethylguanidine (PubChem CID 111762955) has the molecular formula C20H31N3OS and a molecular weight of 361.56 g/mol. Its IUPAC name is 2-(2-benzylsulfinylethyl)-1-[2-(cyclohexen-1-yl)ethyl]-3-ethylguanidine.
| Compound Name | 2-(2-benzylsulfinylethyl)-1-[2-(cyclohexen-1-yl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111762955 |
| Molecular Formula | C20H31N3OS |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 2-(2-benzylsulfinylethyl)-1-[2-(cyclohexen-1-yl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CCS(=O)Cc1ccccc1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H31N3OS/c1-2-21-20(22-14-13-18-9-5-3-6-10-18)23-15-16-25(24)17-19-11-7-4-8-12-19/h4,7-9,11-12H,2-3,5-6,10,13-17H2,1H3,(H2,21,22,23) |
| InChIKey | BDWJYWJLPPDMFH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|