C17H24N4S2 — CID 111767345
1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine (PubChem CID 111767345) has the molecular formula C17H24N4S2 and a molecular weight of 348.54 g/mol. Its IUPAC name is 1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine.
| Compound Name | 1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111767345 |
| Molecular Formula | C17H24N4S2 |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine |
| SMILES | C/N=C(/NCCSc1ccccc1)NCCc1sc(C)nc1C |
| InChI | InChI=1S/C17H24N4S2/c1-13-16(23-14(2)21-13)9-10-19-17(18-3)20-11-12-22-15-7-5-4-6-8-15/h4-8H,9-12H2,1-3H3,(H2,18,19,20) |
| InChIKey | LQHRVBLEODLARD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|