C26H38IN3O3 — CID 111768002
1-ethyl-3-[2-(2-methoxy-5-methylphenyl)ethyl]-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111768002) has the molecular formula C26H38IN3O3 and a molecular weight of 567.51 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-methoxy-5-methylphenyl)ethyl]-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(2-methoxy-5-methylphenyl)ethyl]-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111768002 |
| Molecular Formula | C26H38IN3O3 |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | 1-ethyl-3-[2-(2-methoxy-5-methylphenyl)ethyl]-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(COC2CCOCC2)c1)NCCc1cc(C)ccc1OC.I |
| InChI | InChI=1S/C26H37N3O3.HI/c1-4-27-26(28-13-10-23-16-20(2)8-9-25(23)30-3)29-18-21-6-5-7-22(17-21)19-32-24-11-14-31-15-12-24;/h5-9,16-17,24H,4,10-15,18-19H2,1-3H3,(H2,27,28,29);1H |
| InChIKey | PHBZWOUSJZAHDT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|