C28H31NO — CID 11176961
1-(3,6-ditert-butyl-2-methoxynaphthalen-1-yl)isoquinoline (PubChem CID 11176961) has the molecular formula C28H31NO and a molecular weight of 397.56 g/mol. Its IUPAC name is 1-(3,6-ditert-butyl-2-methoxynaphthalen-1-yl)isoquinoline.
| Compound Name | 1-(3,6-ditert-butyl-2-methoxynaphthalen-1-yl)isoquinoline |
|---|---|
| PubChem CID | 11176961 |
| Molecular Formula | C28H31NO |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 1-(3,6-ditert-butyl-2-methoxynaphthalen-1-yl)isoquinoline |
| SMILES | COc1c(C(C)(C)C)cc2cc(C(C)(C)C)ccc2c1-c1nccc2ccccc12 |
| InChI | InChI=1S/C28H31NO/c1-27(2,3)20-12-13-21-19(16-20)17-23(28(4,5)6)26(30-7)24(21)25-22-11-9-8-10-18(22)14-15-29-25/h8-17H,1-7H3 |
| InChIKey | OAARSTWYCXGTII-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |