C18H30IN5O2 — CID 111770050
1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(4-nitrophenyl)methyl]-3-propylguanidine;hydroiodide (PubChem CID 111770050) has the molecular formula C18H30IN5O2 and a molecular weight of 475.38 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(4-nitrophenyl)methyl]-3-propylguanidine;hydroiodide.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(4-nitrophenyl)methyl]-3-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111770050 |
| Molecular Formula | C18H30IN5O2 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(4-nitrophenyl)methyl]-3-propylguanidine;hydroiodide |
| SMILES | CCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCC1CCCN1CC.I |
| InChI | InChI=1S/C18H29N5O2.HI/c1-3-11-19-18(21-14-17-6-5-12-22(17)4-2)20-13-15-7-9-16(10-8-15)23(24)25;/h7-10,17H,3-6,11-14H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | NSIVNKRUFKJCLU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 82.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|