C20H33IN6S — CID 111771623
2-methyl-1-[4-(2-methylimidazol-1-yl)butyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111771623) has the molecular formula C20H33IN6S and a molecular weight of 516.50 g/mol. Its IUPAC name is 2-methyl-1-[4-(2-methylimidazol-1-yl)butyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[4-(2-methylimidazol-1-yl)butyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111771623 |
| Molecular Formula | C20H33IN6S |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 2-methyl-1-[4-(2-methylimidazol-1-yl)butyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCCn1ccnc1C)NCC(c1cccs1)N1CCCC1.I |
| InChI | InChI=1S/C20H32N6S.HI/c1-17-22-10-14-25(17)11-4-3-9-23-20(21-2)24-16-18(19-8-7-15-27-19)26-12-5-6-13-26;/h7-8,10,14-15,18H,3-6,9,11-13,16H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | RQGKOJLFJGEKQQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|