C15H14Br2O4 — CID 11177546
(1S,2S,5R)-3,4-dibromo-2-(3,4-dimethoxyphenyl)-8-oxabicyclo[3.2.1]octa-3,6-dien-2-ol (PubChem CID 11177546) has the molecular formula C15H14Br2O4 and a molecular weight of 418.08 g/mol. Its IUPAC name is (1S,2S,5R)-3,4-dibromo-2-(3,4-dimethoxyphenyl)-8-oxabicyclo[3.2.1]octa-3,6-dien-2-ol.
| Compound Name | (1S,2S,5R)-3,4-dibromo-2-(3,4-dimethoxyphenyl)-8-oxabicyclo[3.2.1]octa-3,6-dien-2-ol |
|---|---|
| PubChem CID | 11177546 |
| Molecular Formula | C15H14Br2O4 |
| Molecular Weight | 418.08 g/mol |
| Exact Mass | 415.93 |
| IUPAC Name | (1S,2S,5R)-3,4-dibromo-2-(3,4-dimethoxyphenyl)-8-oxabicyclo[3.2.1]octa-3,6-dien-2-ol |
| SMILES | COc1ccc([C@@]2(O)C(Br)=C(Br)[C@H]3C=C[C@@H]2O3)cc1OC |
| InChI | InChI=1S/C15H14Br2O4/c1-19-9-4-3-8(7-11(9)20-2)15(18)12-6-5-10(21-12)13(16)14(15)17/h3-7,10,12,18H,1-2H3/t10-,12+,15+/m1/s1 |
| InChIKey | OCQLYRMQYQBKEG-GMXABZIVSA-N |
| XLogP | 3.23 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.08 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|