C14H11Br2IO3 — CID 134936152
(1S,5R)-3,4-dibromo-2-(3-iodo-4-methoxyphenyl)-8-oxabicyclo[3.2.1]octa-3,6-dien-2-ol (PubChem CID 134936152) has the molecular formula C14H11Br2IO3 and a molecular weight of 513.95 g/mol. Its IUPAC name is (1S,5R)-3,4-dibromo-2-(3-iodo-4-methoxyphenyl)-8-oxabicyclo[3.2.1]octa-3,6-dien-2-ol.
| Compound Name | (1S,5R)-3,4-dibromo-2-(3-iodo-4-methoxyphenyl)-8-oxabicyclo[3.2.1]octa-3,6-dien-2-ol |
|---|---|
| PubChem CID | 134936152 |
| Molecular Formula | C14H11Br2IO3 |
| Molecular Weight | 513.95 g/mol |
| Exact Mass | 511.81 |
| IUPAC Name | (1S,5R)-3,4-dibromo-2-(3-iodo-4-methoxyphenyl)-8-oxabicyclo[3.2.1]octa-3,6-dien-2-ol |
| SMILES | COc1ccc(C2(O)C(Br)=C(Br)[C@H]3C=C[C@@H]2O3)cc1I |
| InChI | InChI=1S/C14H11Br2IO3/c1-19-9-3-2-7(6-8(9)17)14(18)11-5-4-10(20-11)12(15)13(14)16/h2-6,10-11,18H,1H3/t10-,11+,14?/m1/s1 |
| InChIKey | OCKDAQMJFQPXSL-ZAZPPBBNSA-N |
| XLogP | 3.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.95 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|