C21H31FN4O4 — CID 11177682
(2S)-N-(cyclopentylmethyl)-2-[(4-fluorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide (PubChem CID 11177682) has the molecular formula C21H31FN4O4 and a molecular weight of 422.50 g/mol. Its IUPAC name is (2S)-N-(cyclopentylmethyl)-2-[(4-fluorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide.
| Compound Name | (2S)-N-(cyclopentylmethyl)-2-[(4-fluorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 11177682 |
| Molecular Formula | C21H31FN4O4 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (2S)-N-(cyclopentylmethyl)-2-[(4-fluorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)Nc1ccc(F)cc1)C(=O)N(CC(=O)NO)CC1CCCC1 |
| InChI | InChI=1S/C21H31FN4O4/c1-21(2,3)18(24-20(29)23-16-10-8-15(22)9-11-16)19(28)26(13-17(27)25-30)12-14-6-4-5-7-14/h8-11,14,18,30H,4-7,12-13H2,1-3H3,(H,25,27)(H2,23,24,29)/t18-/m1/s1 |
| InChIKey | XOVBBNYAYSBYCI-GOSISDBHSA-N |
| XLogP | 2.89 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|