C13H18FN3O3 — CID 71584424
(2S)-2-[(2-fluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide (PubChem CID 71584424) has the molecular formula C13H18FN3O3 and a molecular weight of 283.30 g/mol. Its IUPAC name is (2S)-2-[(2-fluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide.
| Compound Name | (2S)-2-[(2-fluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide |
|---|---|
| PubChem CID | 71584424 |
| Molecular Formula | C13H18FN3O3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (2S)-2-[(2-fluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)Nc1ccccc1F)C(=O)NO |
| InChI | InChI=1S/C13H18FN3O3/c1-8(2)7-11(12(18)17-20)16-13(19)15-10-6-4-3-5-9(10)14/h3-6,8,11,20H,7H2,1-2H3,(H,17,18)(H2,15,16,19)/t11-/m0/s1 |
| InChIKey | JTSSHCUIUIZLTB-NSHDSACASA-N |
| XLogP | 1.87 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|