C20H32N4O4 — CID 44396597
(R)-2-[(Formyl-hydroxy-amino)-methyl]-hexanoic acid [5-amino-1-((S)-phenylcarbamoyl)-pentyl]-amide (PubChem CID 44396597) has the molecular formula C20H32N4O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is (2R)-N-[(2S)-6-amino-1-anilino-1-oxohexan-2-yl]-2-[[formyl(hydroxy)amino]methyl]hexanamide.
| Compound Name | (R)-2-[(Formyl-hydroxy-amino)-methyl]-hexanoic acid [5-amino-1-((S)-phenylcarbamoyl)-pentyl]-amide |
|---|---|
| PubChem CID | 44396597 |
| Molecular Formula | C20H32N4O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (2R)-N-[(2S)-6-amino-1-anilino-1-oxohexan-2-yl]-2-[[formyl(hydroxy)amino]methyl]hexanamide |
| SMILES | CCCC[C@H](CN(C=O)O)C(=O)N[C@@H](CCCCN)C(=O)NC1=CC=CC=C1 |
| InChI | InChI=1S/C20H32N4O4/c1-2-3-9-16(14-24(28)15-25)19(26)23-18(12-7-8-13-21)20(27)22-17-10-5-4-6-11-17/h4-6,10-11,15-16,18,28H,2-3,7-9,12-14,21H2,1H3,(H,22,27)(H,23,26)/t16-,18+/m1/s1 |
| InChIKey | YKSIUQZREKHXCH-AEFFLSMTSA-N |
| XLogP | 1.60 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | 469 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|