C22H28F2N4O3 — CID 52941619
(2R)-2-(4-fluoro-3,5-dimethylanilino)-6-[(4-fluoro-3-methylphenyl)carbamoylamino]-N-hydroxyhexanamide (PubChem CID 52941619) has the molecular formula C22H28F2N4O3 and a molecular weight of 434.49 g/mol. Its IUPAC name is (2R)-2-(4-fluoro-3,5-dimethylanilino)-6-[(4-fluoro-3-methylphenyl)carbamoylamino]-N-hydroxyhexanamide.
| Compound Name | (2R)-2-(4-fluoro-3,5-dimethylanilino)-6-[(4-fluoro-3-methylphenyl)carbamoylamino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 52941619 |
| Molecular Formula | C22H28F2N4O3 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (2R)-2-(4-fluoro-3,5-dimethylanilino)-6-[(4-fluoro-3-methylphenyl)carbamoylamino]-N-hydroxyhexanamide |
| SMILES | Cc1cc(NC(=O)NCCCC[C@@H](Nc2cc(C)c(F)c(C)c2)C(=O)NO)ccc1F |
| InChI | InChI=1S/C22H28F2N4O3/c1-13-10-16(7-8-18(13)23)27-22(30)25-9-5-4-6-19(21(29)28-31)26-17-11-14(2)20(24)15(3)12-17/h7-8,10-12,19,26,31H,4-6,9H2,1-3H3,(H,28,29)(H2,25,27,30)/t19-/m1/s1 |
| InChIKey | YSGOTQDWSQSGFJ-LJQANCHMSA-N |
| XLogP | 4.17 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|