C22H28N4O3 — CID 111781162
2-methyl-1-[2-(7-methyl-1H-indol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)guanidine (PubChem CID 111781162) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-methyl-1-[2-(7-methyl-1H-indol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)guanidine.
| Compound Name | 2-methyl-1-[2-(7-methyl-1H-indol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111781162 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2-methyl-1-[2-(7-methyl-1H-indol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)guanidine |
| SMILES | C/N=C(\NCCc1c[nH]c2c(C)cccc12)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H28N4O3/c1-14-7-6-8-17-15(13-25-20(14)17)9-10-24-22(23-2)26-16-11-18(27-3)21(29-5)19(12-16)28-4/h6-8,11-13,25H,9-10H2,1-5H3,(H2,23,24,26) |
| InChIKey | PNTSVEOLVCBAIW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|