C17H24ClIN4O — CID 111782130
1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[(3-ethyl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111782130) has the molecular formula C17H24ClIN4O and a molecular weight of 462.76 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[(3-ethyl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[(3-ethyl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111782130 |
| Molecular Formula | C17H24ClIN4O |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[(3-ethyl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(CC)no1)NCCc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C17H23ClN4O.HI/c1-3-15-11-16(23-22-15)12-21-17(19-4-2)20-10-9-13-5-7-14(18)8-6-13;/h5-8,11H,3-4,9-10,12H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | JWMXWIPHWKNGRE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|