C19H33FIN5O3S — CID 111784145
1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[2-(methanesulfonamido)-2-methylpropyl]-2-methylguanidine;hydroiodide (PubChem CID 111784145) has the molecular formula C19H33FIN5O3S and a molecular weight of 557.47 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[2-(methanesulfonamido)-2-methylpropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[2-(methanesulfonamido)-2-methylpropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111784145 |
| Molecular Formula | C19H33FIN5O3S |
| Molecular Weight | 557.47 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[2-(methanesulfonamido)-2-methylpropyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCC(c1ccc(F)cc1)N1CCOCC1)NCC(C)(C)NS(C)(=O)=O.I |
| InChI | InChI=1S/C19H32FN5O3S.HI/c1-19(2,24-29(4,26)27)14-23-18(21-3)22-13-17(25-9-11-28-12-10-25)15-5-7-16(20)8-6-15;/h5-8,17,24H,9-14H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | OAFWLYOOSQKHTF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.47 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|