C21H36FIN4O3S — CID 111635028
1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine;hydroiodide (PubChem CID 111635028) has the molecular formula C21H36FIN4O3S and a molecular weight of 570.51 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111635028 |
| Molecular Formula | C21H36FIN4O3S |
| Molecular Weight | 570.51 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCC(c1ccc(F)cc1)N1CCOCC1)NCC(C)(C)CCS(C)(=O)=O.I |
| InChI | InChI=1S/C21H35FN4O3S.HI/c1-21(2,9-14-30(4,27)28)16-25-20(23-3)24-15-19(26-10-12-29-13-11-26)17-5-7-18(22)8-6-17;/h5-8,19H,9-16H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | XUBMYUIRYGMFMN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|