C20H34FN5O3S — CID 111312520
1-[3-[ethyl(methylsulfonyl)amino]propyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine (PubChem CID 111312520) has the molecular formula C20H34FN5O3S and a molecular weight of 443.59 g/mol. Its IUPAC name is 1-[3-[ethyl(methylsulfonyl)amino]propyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine.
| Compound Name | 1-[3-[ethyl(methylsulfonyl)amino]propyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111312520 |
| Molecular Formula | C20H34FN5O3S |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 1-[3-[ethyl(methylsulfonyl)amino]propyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine |
| SMILES | CCN(CCCN/C(=N\C)NCC(c1ccc(F)cc1)N1CCOCC1)S(C)(=O)=O |
| InChI | InChI=1S/C20H34FN5O3S/c1-4-26(30(3,27)28)11-5-10-23-20(22-2)24-16-19(25-12-14-29-15-13-25)17-6-8-18(21)9-7-17/h6-9,19H,4-5,10-16H2,1-3H3,(H2,22,23,24) |
| InChIKey | DYSOUDZHNWYLQW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|