C18H39N5O3S — CID 111935361
1-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methyl-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine (PubChem CID 111935361) has the molecular formula C18H39N5O3S and a molecular weight of 405.61 g/mol. Its IUPAC name is 1-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methyl-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine.
| Compound Name | 1-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methyl-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine |
|---|---|
| PubChem CID | 111935361 |
| Molecular Formula | C18H39N5O3S |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | 1-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methyl-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine |
| SMILES | CCN(CCCN/C(=N\C)NCC(CC(C)C)N1CCOCC1)S(C)(=O)=O |
| InChI | InChI=1S/C18H39N5O3S/c1-6-23(27(5,24)25)9-7-8-20-18(19-4)21-15-17(14-16(2)3)22-10-12-26-13-11-22/h16-17H,6-15H2,1-5H3,(H2,19,20,21) |
| InChIKey | RIPFIJSEGKJGDK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|