C20H27N3OS — CID 111785341
1-[2-(benzenesulfinyl)ethyl]-3-ethyl-2-(2-phenylpropyl)guanidine (PubChem CID 111785341) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is 1-[2-(benzenesulfinyl)ethyl]-3-ethyl-2-(2-phenylpropyl)guanidine.
| Compound Name | 1-[2-(benzenesulfinyl)ethyl]-3-ethyl-2-(2-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 111785341 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 1-[2-(benzenesulfinyl)ethyl]-3-ethyl-2-(2-phenylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)c1ccccc1)NCCS(=O)c1ccccc1 |
| InChI | InChI=1S/C20H27N3OS/c1-3-21-20(23-16-17(2)18-10-6-4-7-11-18)22-14-15-25(24)19-12-8-5-9-13-19/h4-13,17H,3,14-16H2,1-2H3,(H2,21,22,23) |
| InChIKey | XVABMZFPENSKOK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|