C19H25N5O2 — CID 111787077
1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine (PubChem CID 111787077) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine.
| Compound Name | 1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111787077 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCCCOCc1ccco1)NCc1cn2c(C)cccc2n1 |
| InChI | InChI=1S/C19H25N5O2/c1-15-6-3-8-18-23-16(13-24(15)18)12-22-19(20-2)21-9-5-10-25-14-17-7-4-11-26-17/h3-4,6-8,11,13H,5,9-10,12,14H2,1-2H3,(H2,20,21,22) |
| InChIKey | OTBZNMWFPYJSON-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 76.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|