C22H23FN4OS — CID 111788593
1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 111788593) has the molecular formula C22H23FN4OS and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111788593 |
| Molecular Formula | C22H23FN4OS |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | Fc1ccc2[nH]cc(CCN/C(=N/Cc3cccs3)NCCc3ccco3)c2c1 |
| InChI | InChI=1S/C22H23FN4OS/c23-17-5-6-21-20(13-17)16(14-26-21)7-9-24-22(27-15-19-4-2-12-29-19)25-10-8-18-3-1-11-28-18/h1-6,11-14,26H,7-10,15H2,(H2,24,25,27) |
| InChIKey | KUBDSSOINCEVDM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 65.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|