C22H19FN2O2S — CID 4897660
N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(phenylsulfanylmethyl)furan-3-carboxamide (PubChem CID 4897660) has the molecular formula C22H19FN2O2S and a molecular weight of 394.47 g/mol. Its IUPAC name is N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(phenylsulfanylmethyl)furan-3-carboxamide.
| Compound Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(phenylsulfanylmethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 4897660 |
| Molecular Formula | C22H19FN2O2S |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(phenylsulfanylmethyl)furan-3-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(F)cc12)c1ccoc1CSc1ccccc1 |
| InChI | InChI=1S/C22H19FN2O2S/c23-16-6-7-20-19(12-16)15(13-25-20)8-10-24-22(26)18-9-11-27-21(18)14-28-17-4-2-1-3-5-17/h1-7,9,11-13,25H,8,10,14H2,(H,24,26) |
| InChIKey | BUQWQANXIMAQOM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |