C17H37N3O — CID 111789858
1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-(5-methylhexan-2-yl)guanidine (PubChem CID 111789858) has the molecular formula C17H37N3O and a molecular weight of 299.50 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-(5-methylhexan-2-yl)guanidine.
| Compound Name | 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-(5-methylhexan-2-yl)guanidine |
|---|---|
| PubChem CID | 111789858 |
| Molecular Formula | C17H37N3O |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.29 |
| IUPAC Name | 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-(5-methylhexan-2-yl)guanidine |
| SMILES | CCCC(CCO)C/N=C(\NCC)NC(C)CCC(C)C |
| InChI | InChI=1S/C17H37N3O/c1-6-8-16(11-12-21)13-19-17(18-7-2)20-15(5)10-9-14(3)4/h14-16,21H,6-13H2,1-5H3,(H2,18,19,20) |
| InChIKey | VFSACOFBIXJTPD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|