C19H21IN8 — CID 111791486
2-methyl-1-[(3-pyrazol-1-ylphenyl)methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111791486) has the molecular formula C19H21IN8 and a molecular weight of 488.34 g/mol. Its IUPAC name is 2-methyl-1-[(3-pyrazol-1-ylphenyl)methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(3-pyrazol-1-ylphenyl)methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111791486 |
| Molecular Formula | C19H21IN8 |
| Molecular Weight | 488.34 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 2-methyl-1-[(3-pyrazol-1-ylphenyl)methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(-n2cccn2)c1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C19H20N8.HI/c1-20-19(22-14-18-25-24-17-8-2-3-10-26(17)18)21-13-15-6-4-7-16(12-15)27-11-5-9-23-27;/h2-12H,13-14H2,1H3,(H2,20,21,22);1H |
| InChIKey | YZKSRIHZNGBYHF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|