C17H29N3S — CID 111792851
2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-(4-phenylbutan-2-yl)guanidine (PubChem CID 111792851) has the molecular formula C17H29N3S and a molecular weight of 307.51 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-(4-phenylbutan-2-yl)guanidine.
| Compound Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-(4-phenylbutan-2-yl)guanidine |
|---|---|
| PubChem CID | 111792851 |
| Molecular Formula | C17H29N3S |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-(4-phenylbutan-2-yl)guanidine |
| SMILES | C/N=C(\NCC(C)(C)SC)NC(C)CCc1ccccc1 |
| InChI | InChI=1S/C17H29N3S/c1-14(11-12-15-9-7-6-8-10-15)20-16(18-4)19-13-17(2,3)21-5/h6-10,14H,11-13H2,1-5H3,(H2,18,19,20) |
| InChIKey | LHMNDEORIRTIIW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|