C29H37NO6 — CID 11179458
tert-butyl (2S)-2-[(2R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoyl]oxy-4-methylpentanoate (PubChem CID 11179458) has the molecular formula C29H37NO6 and a molecular weight of 495.62 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoyl]oxy-4-methylpentanoate.
| Compound Name | tert-butyl (2S)-2-[(2R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoyl]oxy-4-methylpentanoate |
|---|---|
| PubChem CID | 11179458 |
| Molecular Formula | C29H37NO6 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | tert-butyl (2S)-2-[(2R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoyl]oxy-4-methylpentanoate |
| SMILES | CC(C)C[C@H](OC(=O)[C@H](C)CNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H37NO6/c1-18(2)15-25(27(32)36-29(4,5)6)35-26(31)19(3)16-30-28(33)34-17-24-22-13-9-7-11-20(22)21-12-8-10-14-23(21)24/h7-14,18-19,24-25H,15-17H2,1-6H3,(H,30,33)/t19-,25+/m1/s1 |
| InChIKey | WMWUGJAQLLUHHS-CLOONOSVSA-N |
| XLogP | 5.46 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|