C26H30IN3O7 — CID 166644004
2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-iodopropanoic acid (PubChem CID 166644004) has the molecular formula C26H30IN3O7 and a molecular weight of 623.44 g/mol. Its IUPAC name is 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-iodopropanoic acid.
| Compound Name | 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-iodopropanoic acid |
|---|---|
| PubChem CID | 166644004 |
| Molecular Formula | C26H30IN3O7 |
| Molecular Weight | 623.44 g/mol |
| Exact Mass | 623.11 |
| IUPAC Name | 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-iodopropanoic acid |
| SMILES | CC(C)(C)OC(=O)NCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC(C)(I)C(=O)O |
| InChI | InChI=1S/C26H30IN3O7/c1-25(2,3)37-23(34)28-13-20(21(31)30-26(4,27)22(32)33)29-24(35)36-14-19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19/h5-12,19-20H,13-14H2,1-4H3,(H,28,34)(H,29,35)(H,30,31)(H,32,33) |
| InChIKey | NEYPRUZPVDZMTC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|